ChemNet > CAS > 176-35-2 1,4-dioxa-7-thiaspiro[4.4]nonane
176-35-2 1,4-dioxa-7-thiaspiro[4.4]nonane
Produkt-Name |
1,4-dioxa-7-thiaspiro[4.4]nonane |
Englischer Name |
1,4-dioxa-7-thiaspiro[4.4]nonane; |
Molekulare Formel |
C6H10O2S |
Molecular Weight |
146.2074 |
InChI |
InChI=1/C6H10O2S/c1-4-9-5-6(1)7-2-3-8-6/h1-5H2 |
CAS Registry Number |
176-35-2 |
Molecular Structure |
|
Dichte |
1.24g/cm3 |
Siedepunkt |
244.7°C at 760 mmHg |
Brechungsindex |
1.546 |
Flammpunkt |
101.8°C |
Dampfdruck |
0.0468mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|